ChemNet > CAS > 175278-50-9 3-{4-[(4-methylphenyl)thio]-3-nitrophenyl}acrylic acid
175278-50-9 3-{4-[(4-methylphenyl)thio]-3-nitrophenyl}acrylic acid
| product Name |
3-{4-[(4-methylphenyl)thio]-3-nitrophenyl}acrylic acid |
| CAS No |
175278-50-9 |
| Synonyms |
3-[4-[(4-Methylphenyl)thio]-3-nitrophenyl]acrylic acid; (2E)-3-{4-[(4-methylphenyl)sulfanyl]-3-nitrophenyl}prop-2-enoic acid |
| Molecular Formula |
C16H13NO4S |
| Molecular Weight |
315.3437 |
| InChI |
InChI=1/C16H13NO4S/c1-11-2-6-13(7-3-11)22-15-8-4-12(5-9-16(18)19)10-14(15)17(20)21/h2-10H,1H3,(H,18,19)/b9-5+ |
| Molecular Structure |
![175278-50-9 3-{4-[(4-methylphenyl)thio]-3-nitrophenyl}acrylic acid](https://images-a.chemnet.com/suppliers/chembase/309/30957.gif)
|
| Density |
1.38g/cm3 |
| Melting point |
217℃ |
| Boiling point |
505°C at 760 mmHg |
| Refractive index |
1.673 |
| Flash point |
259.2°C |
| Vapour Pressur |
5.08E-11mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
